C31H26N6O3 — CID 67238293
N-[3,4-dioxo-1-phenyl-4-(pyridin-2-ylmethylamino)butan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide (PubChem CID 67238293) has the molecular formula C31H26N6O3 and a molecular weight of 530.59 g/mol. Its IUPAC name is N-[3,4-dioxo-1-phenyl-4-(pyridin-2-ylmethylamino)butan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide.
| Compound Name | N-[3,4-dioxo-1-phenyl-4-(pyridin-2-ylmethylamino)butan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67238293 |
| Molecular Formula | C31H26N6O3 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | N-[3,4-dioxo-1-phenyl-4-(pyridin-2-ylmethylamino)butan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccccn1)C(=O)C(Cc1ccccc1)NC(=O)c1cccnc1-n1ccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C31H26N6O3/c38-28(31(40)34-21-24-14-7-8-17-32-24)27(20-22-10-3-1-4-11-22)35-30(39)25-15-9-18-33-29(25)37-19-16-26(36-37)23-12-5-2-6-13-23/h1-19,27H,20-21H2,(H,34,40)(H,35,39) |
| InChIKey | HRVWTUMPVVHRFT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|