C29H27N5O4 — CID 67238372
N-[(2R)-4-(cyclopropylamino)-1-(4-methoxyphenyl)-3,4-dioxobutan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide (PubChem CID 67238372) has the molecular formula C29H27N5O4 and a molecular weight of 509.57 g/mol. Its IUPAC name is N-[(2R)-4-(cyclopropylamino)-1-(4-methoxyphenyl)-3,4-dioxobutan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide.
| Compound Name | N-[(2R)-4-(cyclopropylamino)-1-(4-methoxyphenyl)-3,4-dioxobutan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67238372 |
| Molecular Formula | C29H27N5O4 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | N-[(2R)-4-(cyclopropylamino)-1-(4-methoxyphenyl)-3,4-dioxobutan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
| SMILES | COc1ccc(C[C@@H](NC(=O)c2cccnc2-n2ccc(-c3ccccc3)n2)C(=O)C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C29H27N5O4/c1-38-22-13-9-19(10-14-22)18-25(26(35)29(37)31-21-11-12-21)32-28(36)23-8-5-16-30-27(23)34-17-15-24(33-34)20-6-3-2-4-7-20/h2-10,13-17,21,25H,11-12,18H2,1H3,(H,31,37)(H,32,36)/t25-/m1/s1 |
| InChIKey | BWYWZFXBJPNSNR-RUZDIDTESA-N |
| XLogP | 3.13 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|