C31H32N6O5 — CID 87321127
N-[(2S)-4-(2-morpholin-4-ylethoxyamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide (PubChem CID 87321127) has the molecular formula C31H32N6O5 and a molecular weight of 568.63 g/mol. Its IUPAC name is N-[(2S)-4-(2-morpholin-4-ylethoxyamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide.
| Compound Name | N-[(2S)-4-(2-morpholin-4-ylethoxyamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87321127 |
| Molecular Formula | C31H32N6O5 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | N-[(2S)-4-(2-morpholin-4-ylethoxyamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
| SMILES | O=C(NOCCN1CCOCC1)C(=O)[C@H](Cc1ccccc1)NC(=O)c1cccnc1-n1ccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C31H32N6O5/c38-28(31(40)35-42-21-18-36-16-19-41-20-17-36)27(22-23-8-3-1-4-9-23)33-30(39)25-12-7-14-32-29(25)37-15-13-26(34-37)24-10-5-2-6-11-24/h1-15,27H,16-22H2,(H,33,39)(H,35,40)/t27-/m0/s1 |
| InChIKey | PRBKNMKLCMZVAI-MHZLTWQESA-N |
| XLogP | 2.22 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|