C30H30N6O4 — CID 66719988
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[3-[3-(morpholin-4-ylmethyl)phenyl]pyrazol-1-yl]pyridine-3-carboxamide (PubChem CID 66719988) has the molecular formula C30H30N6O4 and a molecular weight of 538.61 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[3-[3-(morpholin-4-ylmethyl)phenyl]pyrazol-1-yl]pyridine-3-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[3-[3-(morpholin-4-ylmethyl)phenyl]pyrazol-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66719988 |
| Molecular Formula | C30H30N6O4 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[3-[3-(morpholin-4-ylmethyl)phenyl]pyrazol-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1cccnc1-n1ccc(-c2cccc(CN3CCOCC3)c2)n1 |
| InChI | InChI=1S/C30H30N6O4/c31-28(38)27(37)26(19-21-6-2-1-3-7-21)33-30(39)24-10-5-12-32-29(24)36-13-11-25(34-36)23-9-4-8-22(18-23)20-35-14-16-40-17-15-35/h1-13,18,26H,14-17,19-20H2,(H2,31,38)(H,33,39) |
| InChIKey | UWVQDKULSBIZLS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 132.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|