C25H20ClN5O3 — CID 66719944
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-chloro-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide (PubChem CID 66719944) has the molecular formula C25H20ClN5O3 and a molecular weight of 473.92 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-chloro-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-chloro-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66719944 |
| Molecular Formula | C25H20ClN5O3 |
| Molecular Weight | 473.92 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-chloro-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1cc(Cl)cnc1-n1ccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H20ClN5O3/c26-18-14-19(24(28-15-18)31-12-11-20(30-31)17-9-5-2-6-10-17)25(34)29-21(22(32)23(27)33)13-16-7-3-1-4-8-16/h1-12,14-15,21H,13H2,(H2,27,33)(H,29,34) |
| InChIKey | YCILZHPDNCWIFO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.92 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|