C26H22FN5O4 — CID 53258820
2-[3-(4-fluorophenyl)pyrazol-1-yl]-N-[4-(methoxyamino)-3,4-dioxo-1-phenylbutan-2-yl]pyridine-3-carboxamide (PubChem CID 53258820) has the molecular formula C26H22FN5O4 and a molecular weight of 487.49 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)pyrazol-1-yl]-N-[4-(methoxyamino)-3,4-dioxo-1-phenylbutan-2-yl]pyridine-3-carboxamide.
| Compound Name | 2-[3-(4-fluorophenyl)pyrazol-1-yl]-N-[4-(methoxyamino)-3,4-dioxo-1-phenylbutan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 53258820 |
| Molecular Formula | C26H22FN5O4 |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 2-[3-(4-fluorophenyl)pyrazol-1-yl]-N-[4-(methoxyamino)-3,4-dioxo-1-phenylbutan-2-yl]pyridine-3-carboxamide |
| SMILES | CONC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1cccnc1-n1ccc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C26H22FN5O4/c1-36-31-26(35)23(33)22(16-17-6-3-2-4-7-17)29-25(34)20-8-5-14-28-24(20)32-15-13-21(30-32)18-9-11-19(27)12-10-18/h2-15,22H,16H2,1H3,(H,29,34)(H,31,35) |
| InChIKey | UWLUVALNFSPXEY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|