C23H19N5O3S — CID 66720117
N-(4-amino-3,4-dioxo-1-thiophen-2-ylbutan-2-yl)-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide (PubChem CID 66720117) has the molecular formula C23H19N5O3S and a molecular weight of 445.50 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-thiophen-2-ylbutan-2-yl)-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-thiophen-2-ylbutan-2-yl)-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66720117 |
| Molecular Formula | C23H19N5O3S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-thiophen-2-ylbutan-2-yl)-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1cccs1)NC(=O)c1cccnc1-n1ccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H19N5O3S/c24-21(30)20(29)19(14-16-8-5-13-32-16)26-23(31)17-9-4-11-25-22(17)28-12-10-18(27-28)15-6-2-1-3-7-15/h1-13,19H,14H2,(H2,24,30)(H,26,31) |
| InChIKey | CYGQXBKVZHBPDP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|