C19H18N6O3 — CID 149188122
N-(4-amino-3,4-dioxo-1-pyridin-2-ylbutan-2-yl)-5-methyl-4-pyridin-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 149188122) has the molecular formula C19H18N6O3 and a molecular weight of 378.39 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-pyridin-2-ylbutan-2-yl)-5-methyl-4-pyridin-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-pyridin-2-ylbutan-2-yl)-5-methyl-4-pyridin-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 149188122 |
| Molecular Formula | C19H18N6O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-pyridin-2-ylbutan-2-yl)-5-methyl-4-pyridin-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)NC(Cc2ccccn2)C(=O)C(N)=O)c1-c1ccccn1 |
| InChI | InChI=1S/C19H18N6O3/c1-11-15(13-7-3-5-9-22-13)16(25-24-11)19(28)23-14(17(26)18(20)27)10-12-6-2-4-8-21-12/h2-9,14H,10H2,1H3,(H2,20,27)(H,23,28)(H,24,25) |
| InChIKey | XCGRDRLNCRNDIH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|