C19H19N7O3 — CID 153386236
3-[[(Z,2Z)-4-amino-2-pyridin-2-yliminobut-3-enoyl]amino]-4-(1,4-dihydropyrrolo[3,2-b]pyrrol-6-yl)-2-oxobutanamide (PubChem CID 153386236) has the molecular formula C19H19N7O3 and a molecular weight of 393.41 g/mol. Its IUPAC name is 3-[[(Z,2Z)-4-amino-2-pyridin-2-yliminobut-3-enoyl]amino]-4-(1,4-dihydropyrrolo[3,2-b]pyrrol-6-yl)-2-oxobutanamide.
| Compound Name | 3-[[(Z,2Z)-4-amino-2-pyridin-2-yliminobut-3-enoyl]amino]-4-(1,4-dihydropyrrolo[3,2-b]pyrrol-6-yl)-2-oxobutanamide |
|---|---|
| PubChem CID | 153386236 |
| Molecular Formula | C19H19N7O3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 3-[[(Z,2Z)-4-amino-2-pyridin-2-yliminobut-3-enoyl]amino]-4-(1,4-dihydropyrrolo[3,2-b]pyrrol-6-yl)-2-oxobutanamide |
| SMILES | N/C=C\C(=N\c1ccccn1)C(=O)NC(Cc1c[nH]c2cc[nH]c12)C(=O)C(N)=O |
| InChI | InChI=1S/C19H19N7O3/c20-6-4-13(25-15-3-1-2-7-22-15)19(29)26-14(17(27)18(21)28)9-11-10-24-12-5-8-23-16(11)12/h1-8,10,14,23-24H,9,20H2,(H2,21,28)(H,26,29)/b6-4-,25-13- |
| InChIKey | PWBORZYTZMOBLN-VHQYYFNDSA-N |
| XLogP | 0.22 |
| TPSA | 172.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|