C17H14N4O3S2 — CID 153386125
N-(4-amino-3,4-dioxo-1-thiophen-2-ylbutan-2-yl)-4-pyridin-2-yl-1,2-thiazole-5-carboxamide (PubChem CID 153386125) has the molecular formula C17H14N4O3S2 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-thiophen-2-ylbutan-2-yl)-4-pyridin-2-yl-1,2-thiazole-5-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-thiophen-2-ylbutan-2-yl)-4-pyridin-2-yl-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 153386125 |
| Molecular Formula | C17H14N4O3S2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-thiophen-2-ylbutan-2-yl)-4-pyridin-2-yl-1,2-thiazole-5-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1cccs1)NC(=O)c1sncc1-c1ccccn1 |
| InChI | InChI=1S/C17H14N4O3S2/c18-16(23)14(22)13(8-10-4-3-7-25-10)21-17(24)15-11(9-20-26-15)12-5-1-2-6-19-12/h1-7,9,13H,8H2,(H2,18,23)(H,21,24) |
| InChIKey | CADBXQACMBFCFO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|