C18H17N5O3S — CID 153386001
N-(4-amino-3,4-dioxo-1-thiophen-2-ylbutan-2-yl)-5-methyl-1-pyridin-2-ylimidazole-2-carboxamide (PubChem CID 153386001) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-thiophen-2-ylbutan-2-yl)-5-methyl-1-pyridin-2-ylimidazole-2-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-thiophen-2-ylbutan-2-yl)-5-methyl-1-pyridin-2-ylimidazole-2-carboxamide |
|---|---|
| PubChem CID | 153386001 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-thiophen-2-ylbutan-2-yl)-5-methyl-1-pyridin-2-ylimidazole-2-carboxamide |
| SMILES | Cc1cnc(C(=O)NC(Cc2cccs2)C(=O)C(N)=O)n1-c1ccccn1 |
| InChI | InChI=1S/C18H17N5O3S/c1-11-10-21-17(23(11)14-6-2-3-7-20-14)18(26)22-13(15(24)16(19)25)9-12-5-4-8-27-12/h2-8,10,13H,9H2,1H3,(H2,19,25)(H,22,26) |
| InChIKey | CWDCRWMLWLWINM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|