C21H19N3O4 — CID 147683869
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-methyl-4-phenyl-1,2-oxazole-5-carboxamide (PubChem CID 147683869) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-methyl-4-phenyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-methyl-4-phenyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 147683869 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-methyl-4-phenyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1noc(C(=O)NC(Cc2ccccc2)C(=O)C(N)=O)c1-c1ccccc1 |
| InChI | InChI=1S/C21H19N3O4/c1-13-17(15-10-6-3-7-11-15)19(28-24-13)21(27)23-16(18(25)20(22)26)12-14-8-4-2-5-9-14/h2-11,16H,12H2,1H3,(H2,22,26)(H,23,27) |
| InChIKey | GPQJAORMKUCTKT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|