C21H20N4O3 — CID 153484005
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-4-methyl-2-phenylimidazole-1-carboxamide (PubChem CID 153484005) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-4-methyl-2-phenylimidazole-1-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-4-methyl-2-phenylimidazole-1-carboxamide |
|---|---|
| PubChem CID | 153484005 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-4-methyl-2-phenylimidazole-1-carboxamide |
| SMILES | Cc1cn(C(=O)NC(Cc2ccccc2)C(=O)C(N)=O)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H20N4O3/c1-14-13-25(20(23-14)16-10-6-3-7-11-16)21(28)24-17(18(26)19(22)27)12-15-8-4-2-5-9-15/h2-11,13,17H,12H2,1H3,(H2,22,27)(H,24,28) |
| InChIKey | ZVJRXAVZOFXYLX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|