C22H22N4O3 — CID 167072965
3-[(3-benzoyl-1-methylpyrazol-4-yl)methylamino]-2-oxo-4-phenylbutanamide (PubChem CID 167072965) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 3-[(3-benzoyl-1-methylpyrazol-4-yl)methylamino]-2-oxo-4-phenylbutanamide.
| Compound Name | 3-[(3-benzoyl-1-methylpyrazol-4-yl)methylamino]-2-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 167072965 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 3-[(3-benzoyl-1-methylpyrazol-4-yl)methylamino]-2-oxo-4-phenylbutanamide |
| SMILES | Cn1cc(CNC(Cc2ccccc2)C(=O)C(N)=O)c(C(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C22H22N4O3/c1-26-14-17(19(25-26)20(27)16-10-6-3-7-11-16)13-24-18(21(28)22(23)29)12-15-8-4-2-5-9-15/h2-11,14,18,24H,12-13H2,1H3,(H2,23,29) |
| InChIKey | ZEPQTRKFDKWKOI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|