C20H21N3O2 — CID 99779368
(2S)-2-[(3-methyl-1-phenylpyrazol-4-yl)methylamino]-3-phenylpropanoic acid (PubChem CID 99779368) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is (2S)-2-[(3-methyl-1-phenylpyrazol-4-yl)methylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(3-methyl-1-phenylpyrazol-4-yl)methylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 99779368 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (2S)-2-[(3-methyl-1-phenylpyrazol-4-yl)methylamino]-3-phenylpropanoic acid |
| SMILES | Cc1nn(-c2ccccc2)cc1CN[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H21N3O2/c1-15-17(14-23(22-15)18-10-6-3-7-11-18)13-21-19(20(24)25)12-16-8-4-2-5-9-16/h2-11,14,19,21H,12-13H2,1H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | OMEFOAFMTGXHIB-IBGZPJMESA-N |
| XLogP | 2.97 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |