C19H25ClN6O3 — CID 155757629
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-methyl-3-piperazin-1-ylpyrazole-4-carboxamide;hydrochloride (PubChem CID 155757629) has the molecular formula C19H25ClN6O3 and a molecular weight of 420.90 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-methyl-3-piperazin-1-ylpyrazole-4-carboxamide;hydrochloride.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-methyl-3-piperazin-1-ylpyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 155757629 |
| Molecular Formula | C19H25ClN6O3 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-methyl-3-piperazin-1-ylpyrazole-4-carboxamide;hydrochloride |
| SMILES | Cl.Cn1cc(C(=O)NC(Cc2ccccc2)C(=O)C(N)=O)c(N2CCNCC2)n1 |
| InChI | InChI=1S/C19H24N6O3.ClH/c1-24-12-14(18(23-24)25-9-7-21-8-10-25)19(28)22-15(16(26)17(20)27)11-13-5-3-2-4-6-13;/h2-6,12,15,21H,7-11H2,1H3,(H2,20,27)(H,22,28);1H |
| InChIKey | NOIVXZFMDQRTTN-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 122.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|