C20H29N3O2 — CID 122046059
4-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-5-phenylpentanoic acid (PubChem CID 122046059) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 4-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122046059 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 4-[(3-tert-butyl-1-methylpyrazol-4-yl)methylamino]-5-phenylpentanoic acid |
| SMILES | Cn1cc(CNC(CCC(=O)O)Cc2ccccc2)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C20H29N3O2/c1-20(2,3)19-16(14-23(4)22-19)13-21-17(10-11-18(24)25)12-15-8-6-5-7-9-15/h5-9,14,17,21H,10-13H2,1-4H3,(H,24,25) |
| InChIKey | RXKVLPUHRSAUCP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |