C22H24N2O3 — CID 122045771
4-[(3-benzyl-1,2-oxazol-4-yl)methylamino]-5-phenylpentanoic acid (PubChem CID 122045771) has the molecular formula C22H24N2O3 and a molecular weight of 364.44 g/mol. Its IUPAC name is 4-[(3-benzyl-1,2-oxazol-4-yl)methylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(3-benzyl-1,2-oxazol-4-yl)methylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122045771 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 4-[(3-benzyl-1,2-oxazol-4-yl)methylamino]-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NCc1conc1Cc1ccccc1 |
| InChI | InChI=1S/C22H24N2O3/c25-22(26)12-11-20(13-17-7-3-1-4-8-17)23-15-19-16-27-24-21(19)14-18-9-5-2-6-10-18/h1-10,16,20,23H,11-15H2,(H,25,26) |
| InChIKey | XPCHSWSJYSHSRQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |