C19H17N5O4 — CID 153385801
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-methyl-4-pyrimidin-4-yl-1,2-oxazole-5-carboxamide (PubChem CID 153385801) has the molecular formula C19H17N5O4 and a molecular weight of 379.38 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-methyl-4-pyrimidin-4-yl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-methyl-4-pyrimidin-4-yl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 153385801 |
| Molecular Formula | C19H17N5O4 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-methyl-4-pyrimidin-4-yl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1noc(C(=O)NC(Cc2ccccc2)C(=O)C(N)=O)c1-c1ccncn1 |
| InChI | InChI=1S/C19H17N5O4/c1-11-15(13-7-8-21-10-22-13)17(28-24-11)19(27)23-14(16(25)18(20)26)9-12-5-3-2-4-6-12/h2-8,10,14H,9H2,1H3,(H2,20,26)(H,23,27) |
| InChIKey | BCCZAOVIWWAZMC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 141.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|