C19H16ClN3O5 — CID 153386164
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-4-(2-chlorofuran-3-yl)-2-methyl-1,3-oxazole-5-carboxamide (PubChem CID 153386164) has the molecular formula C19H16ClN3O5 and a molecular weight of 401.81 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-4-(2-chlorofuran-3-yl)-2-methyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-4-(2-chlorofuran-3-yl)-2-methyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 153386164 |
| Molecular Formula | C19H16ClN3O5 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-4-(2-chlorofuran-3-yl)-2-methyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccoc2Cl)c(C(=O)NC(Cc2ccccc2)C(=O)C(N)=O)o1 |
| InChI | InChI=1S/C19H16ClN3O5/c1-10-22-14(12-7-8-27-17(12)20)16(28-10)19(26)23-13(15(24)18(21)25)9-11-5-3-2-4-6-11/h2-8,13H,9H2,1H3,(H2,21,25)(H,23,26) |
| InChIKey | UMAAGWDWMFKUJM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 128.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|