C22H18F3N3O7S — CID 134397425
[4-[(2S)-4-amino-2-[(2-methyl-4-phenyl-1,3-oxazole-5-carbonyl)amino]-3,4-dioxobutyl]phenyl] trifluoromethanesulfonate (PubChem CID 134397425) has the molecular formula C22H18F3N3O7S and a molecular weight of 525.46 g/mol. Its IUPAC name is [4-[(2S)-4-amino-2-[(2-methyl-4-phenyl-1,3-oxazole-5-carbonyl)amino]-3,4-dioxobutyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(2S)-4-amino-2-[(2-methyl-4-phenyl-1,3-oxazole-5-carbonyl)amino]-3,4-dioxobutyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134397425 |
| Molecular Formula | C22H18F3N3O7S |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | [4-[(2S)-4-amino-2-[(2-methyl-4-phenyl-1,3-oxazole-5-carbonyl)amino]-3,4-dioxobutyl]phenyl] trifluoromethanesulfonate |
| SMILES | Cc1nc(-c2ccccc2)c(C(=O)N[C@@H](Cc2ccc(OS(=O)(=O)C(F)(F)F)cc2)C(=O)C(N)=O)o1 |
| InChI | InChI=1S/C22H18F3N3O7S/c1-12-27-17(14-5-3-2-4-6-14)19(34-12)21(31)28-16(18(29)20(26)30)11-13-7-9-15(10-8-13)35-36(32,33)22(23,24)25/h2-10,16H,11H2,1H3,(H2,26,30)(H,28,31)/t16-/m0/s1 |
| InChIKey | GIMCLCZOUOOWQT-INIZCTEOSA-N |
| XLogP | 2.27 |
| TPSA | 158.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|