C19H18F3NO6S — CID 87446530
benzyl (2S)-2-acetamido-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate (PubChem CID 87446530) has the molecular formula C19H18F3NO6S and a molecular weight of 445.42 g/mol. Its IUPAC name is benzyl (2S)-2-acetamido-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate.
| Compound Name | benzyl (2S)-2-acetamido-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 87446530 |
| Molecular Formula | C19H18F3NO6S |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | benzyl (2S)-2-acetamido-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate |
| SMILES | CC(=O)N[C@@H](Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H18F3NO6S/c1-13(24)23-17(18(25)28-12-15-5-3-2-4-6-15)11-14-7-9-16(10-8-14)29-30(26,27)19(20,21)22/h2-10,17H,11-12H2,1H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | SSGDDGYVTQTQBR-KRWDZBQOSA-N |
| XLogP | 2.71 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|