C19H17N5O4 — CID 153385879
3-[(1-methyl-3-pyrimidin-4-ylpyrazole-4-carbonyl)amino]-2-oxo-4-phenylbutanoic acid (PubChem CID 153385879) has the molecular formula C19H17N5O4 and a molecular weight of 379.38 g/mol. Its IUPAC name is 3-[(1-methyl-3-pyrimidin-4-ylpyrazole-4-carbonyl)amino]-2-oxo-4-phenylbutanoic acid.
| Compound Name | 3-[(1-methyl-3-pyrimidin-4-ylpyrazole-4-carbonyl)amino]-2-oxo-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 153385879 |
| Molecular Formula | C19H17N5O4 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 3-[(1-methyl-3-pyrimidin-4-ylpyrazole-4-carbonyl)amino]-2-oxo-4-phenylbutanoic acid |
| SMILES | Cn1cc(C(=O)NC(Cc2ccccc2)C(=O)C(=O)O)c(-c2ccncn2)n1 |
| InChI | InChI=1S/C19H17N5O4/c1-24-10-13(16(23-24)14-7-8-20-11-21-14)18(26)22-15(17(25)19(27)28)9-12-5-3-2-4-6-12/h2-8,10-11,15H,9H2,1H3,(H,22,26)(H,27,28) |
| InChIKey | DABGMXRFXACPER-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|