C17H17N5O4 — CID 153386288
3-[[(E)-3-amino-2-methanimidoyl-3-pyridin-2-ylprop-2-enoyl]amino]-4-(furan-3-yl)-2-oxobutanamide (PubChem CID 153386288) has the molecular formula C17H17N5O4 and a molecular weight of 355.35 g/mol. Its IUPAC name is 3-[[(E)-3-amino-2-methanimidoyl-3-pyridin-2-ylprop-2-enoyl]amino]-4-(furan-3-yl)-2-oxobutanamide.
| Compound Name | 3-[[(E)-3-amino-2-methanimidoyl-3-pyridin-2-ylprop-2-enoyl]amino]-4-(furan-3-yl)-2-oxobutanamide |
|---|---|
| PubChem CID | 153386288 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 3-[[(E)-3-amino-2-methanimidoyl-3-pyridin-2-ylprop-2-enoyl]amino]-4-(furan-3-yl)-2-oxobutanamide |
| SMILES | [H]/N=C/C(C(=O)NC(Cc1ccoc1)C(=O)C(N)=O)=C(\N)c1ccccn1 |
| InChI | InChI=1S/C17H17N5O4/c18-8-11(14(19)12-3-1-2-5-21-12)17(25)22-13(15(23)16(20)24)7-10-4-6-26-9-10/h1-6,8-9,13,18H,7,19H2,(H2,20,24)(H,22,25)/b14-11+,18-8+ |
| InChIKey | DJSGVLDPQISOJO-XCGAKDHTSA-N |
| XLogP | -0.22 |
| TPSA | 165.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|