About butan-1-imine;pyridine-2-carboxamide
butan-1-imine;pyridine-2-carboxamide (PubChem CID 143815208) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is butan-1-imine;pyridine-2-carboxamide.
Molecular Properties
| Compound Name | butan-1-imine;pyridine-2-carboxamide |
| PubChem CID | 143815208 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | butan-1-imine;pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccccn1.[H]/N=C/CCC |
| InChI | InChI=1S/C6H6N2O.C4H9N/c7-6(9)5-3-1-2-4-8-5;1-2-3-4-5/h1-4H,(H2,7,9);4-5H,2-3H2,1H3/b;5-4+ |
| InChIKey | TWVCIAJJUGOSFC-RCKHEGBHSA-N |
| XLogP | 1.62 |
| TPSA | 79.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze butan-1-imine;pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-imine;pyridine-2-carboxamide?
The IUPAC name of butan-1-imine;pyridine-2-carboxamide (CID 143815208) is butan-1-imine;pyridine-2-carboxamide.
What is the SMILES notation for butan-1-imine;pyridine-2-carboxamide?
The canonical SMILES for butan-1-imine;pyridine-2-carboxamide is NC(=O)c1ccccn1.[H]/N=C/CCC.
What is the InChIKey of butan-1-imine;pyridine-2-carboxamide?
The InChIKey is TWVCIAJJUGOSFC-RCKHEGBHSA-N. The full InChI is InChI=1S/C6H6N2O.C4H9N/c7-6(9)5-3-1-2-4-8-5;1-2-3-4-5/h1-4H,(H2,7,9);4-5H,2-3H2,1H3/b;5-4+.
What are the key properties of butan-1-imine;pyridine-2-carboxamide?
butan-1-imine;pyridine-2-carboxamide has a molecular weight of 193.25 g/mol, XLogP of 1.62, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-imine;pyridine-2-carboxamide is sourced from PubChem (CID 143815208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).