C10H12N2O7 — CID 174601902
2,3-dihydroxybutanedioic acid;pyridine-2-carboxamide (PubChem CID 174601902) has the molecular formula C10H12N2O7 and a molecular weight of 272.21 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;pyridine-2-carboxamide.
| Compound Name | 2,3-dihydroxybutanedioic acid;pyridine-2-carboxamide |
|---|---|
| PubChem CID | 174601902 |
| Molecular Formula | C10H12N2O7 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccccn1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C6H6N2O.C4H6O6/c7-6(9)5-3-1-2-4-8-5;5-1(3(7)8)2(6)4(9)10/h1-4H,(H2,7,9);1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | SBQGKUJWOAHHAX-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 171.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |