About pyridine-2-carboxamide;thiophen-2-amine
pyridine-2-carboxamide;thiophen-2-amine (PubChem CID 69368078) has the molecular formula C10H11N3OS
and a molecular weight of 221.29 g/mol. Its IUPAC name is pyridine-2-carboxamide;thiophen-2-amine.
Molecular Properties
| Compound Name | pyridine-2-carboxamide;thiophen-2-amine |
| PubChem CID | 69368078 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | pyridine-2-carboxamide;thiophen-2-amine |
| SMILES | NC(=O)c1ccccn1.Nc1cccs1 |
| InChI | InChI=1S/C6H6N2O.C4H5NS/c7-6(9)5-3-1-2-4-8-5;5-4-2-1-3-6-4/h1-4H,(H2,7,9);1-3H,5H2 |
| InChIKey | ISTMKIFRFJQXJM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridine-2-carboxamide;thiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-2-carboxamide;thiophen-2-amine?
The IUPAC name of pyridine-2-carboxamide;thiophen-2-amine (CID 69368078) is pyridine-2-carboxamide;thiophen-2-amine.
What is the SMILES notation for pyridine-2-carboxamide;thiophen-2-amine?
The canonical SMILES for pyridine-2-carboxamide;thiophen-2-amine is NC(=O)c1ccccn1.Nc1cccs1.
What is the InChIKey of pyridine-2-carboxamide;thiophen-2-amine?
The InChIKey is ISTMKIFRFJQXJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O.C4H5NS/c7-6(9)5-3-1-2-4-8-5;5-4-2-1-3-6-4/h1-4H,(H2,7,9);1-3H,5H2.
What are the key properties of pyridine-2-carboxamide;thiophen-2-amine?
pyridine-2-carboxamide;thiophen-2-amine has a molecular weight of 221.29 g/mol, XLogP of 1.51, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-2-carboxamide;thiophen-2-amine is sourced from PubChem (CID 69368078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).