C20H21N5O3 — CID 167600571
3-[[3-amino-2-(methyliminomethyl)-3-pyridin-4-ylprop-2-enoyl]amino]-2-oxo-4-phenylbutanamide (PubChem CID 167600571) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 3-[[3-amino-2-(methyliminomethyl)-3-pyridin-4-ylprop-2-enoyl]amino]-2-oxo-4-phenylbutanamide.
| Compound Name | 3-[[3-amino-2-(methyliminomethyl)-3-pyridin-4-ylprop-2-enoyl]amino]-2-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 167600571 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-[[3-amino-2-(methyliminomethyl)-3-pyridin-4-ylprop-2-enoyl]amino]-2-oxo-4-phenylbutanamide |
| SMILES | C/N=C/C(C(=O)NC(Cc1ccccc1)C(=O)C(N)=O)=C(N)c1ccncc1 |
| InChI | InChI=1S/C20H21N5O3/c1-23-12-15(17(21)14-7-9-24-10-8-14)20(28)25-16(18(26)19(22)27)11-13-5-3-2-4-6-13/h2-10,12,16H,11,21H2,1H3,(H2,22,27)(H,25,28)/b17-15?,23-12+ |
| InChIKey | YPLNNRDDPRJYEN-GNDWSJMASA-N |
| XLogP | 0.23 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|