C20H20N2O4 — CID 44581193
(3S)-2-oxo-3-[(4-oxo-4-phenylbutanoyl)amino]-4-phenylbutanamide (PubChem CID 44581193) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is (3S)-2-oxo-3-[(4-oxo-4-phenylbutanoyl)amino]-4-phenylbutanamide.
| Compound Name | (3S)-2-oxo-3-[(4-oxo-4-phenylbutanoyl)amino]-4-phenylbutanamide |
|---|---|
| PubChem CID | 44581193 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (3S)-2-oxo-3-[(4-oxo-4-phenylbutanoyl)amino]-4-phenylbutanamide |
| SMILES | NC(=O)C(=O)[C@H](Cc1ccccc1)NC(=O)CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O4/c21-20(26)19(25)16(13-14-7-3-1-4-8-14)22-18(24)12-11-17(23)15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H2,21,26)(H,22,24)/t16-/m0/s1 |
| InChIKey | QERIEXWOSMJFTA-INIZCTEOSA-N |
| XLogP | 1.43 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|