C17H15N5O4 — CID 153386324
N-[4-amino-1-(furan-3-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1H-pyrazole-5-carboxamide (PubChem CID 153386324) has the molecular formula C17H15N5O4 and a molecular weight of 353.34 g/mol. Its IUPAC name is N-[4-amino-1-(furan-3-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-amino-1-(furan-3-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 153386324 |
| Molecular Formula | C17H15N5O4 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | N-[4-amino-1-(furan-3-yl)-3,4-dioxobutan-2-yl]-4-pyridin-2-yl-1H-pyrazole-5-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccoc1)NC(=O)c1[nH]ncc1-c1ccccn1 |
| InChI | InChI=1S/C17H15N5O4/c18-16(24)15(23)13(7-10-4-6-26-9-10)21-17(25)14-11(8-20-22-14)12-3-1-2-5-19-12/h1-6,8-9,13H,7H2,(H2,18,24)(H,20,22)(H,21,25) |
| InChIKey | JTOGMBJCKKTULE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 143.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|