methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate

C15H11N3O3 — CID 12789660

IUPACmethyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate
SMILESCOC(=O)c1ccccc1-c1noc(-c2ccccn2)n1
InChIInChI=1S/C15H11N3O3/c1-20-15(19)11-7-3-2-6-10(11)13-17-14(21-18-13)12-8-4-5-9-16-12/h2-9H,1H3
InChIKeyWINFWXHRTNEBHW-UHFFFAOYSA-N
MW281.27 g/mol
LogP2.59
Rot. Bonds3

About methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate

methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate (PubChem CID 12789660) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate.

Molecular Properties

Compound Namemethyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate
PubChem CID12789660
Molecular FormulaC15H11N3O3
Molecular Weight281.27 g/mol
Exact Mass281.08
IUPAC Namemethyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate
SMILESCOC(=O)c1ccccc1-c1noc(-c2ccccn2)n1
InChIInChI=1S/C15H11N3O3/c1-20-15(19)11-7-3-2-6-10(11)13-17-14(21-18-13)12-8-4-5-9-16-12/h2-9H,1H3
InChIKeyWINFWXHRTNEBHW-UHFFFAOYSA-N
XLogP2.59
TPSA78.11 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.27
LogP ≤ 52.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate?
The IUPAC name of methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate (CID 12789660) is methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate.
What is the SMILES notation for methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate?
The canonical SMILES for methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate is COC(=O)c1ccccc1-c1noc(-c2ccccn2)n1.
What is the InChIKey of methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate?
The InChIKey is WINFWXHRTNEBHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O3/c1-20-15(19)11-7-3-2-6-10(11)13-17-14(21-18-13)12-8-4-5-9-16-12/h2-9H,1H3.
What are the key properties of methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate?
methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate has a molecular weight of 281.27 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate is sourced from PubChem (CID 12789660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).