C15H11N3O3 — CID 12789660
methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate (PubChem CID 12789660) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate.
| Compound Name | methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate |
|---|---|
| PubChem CID | 12789660 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | methyl 2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)benzoate |
| SMILES | COC(=O)c1ccccc1-c1noc(-c2ccccn2)n1 |
| InChI | InChI=1S/C15H11N3O3/c1-20-15(19)11-7-3-2-6-10(11)13-17-14(21-18-13)12-8-4-5-9-16-12/h2-9H,1H3 |
| InChIKey | WINFWXHRTNEBHW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |