C8H8N4O — CID 146482202
N-methyl-5-pyridin-2-yl-1,2,4-oxadiazol-3-amine (PubChem CID 146482202) has the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. Its IUPAC name is N-methyl-5-pyridin-2-yl-1,2,4-oxadiazol-3-amine.
| Compound Name | N-methyl-5-pyridin-2-yl-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 146482202 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | N-methyl-5-pyridin-2-yl-1,2,4-oxadiazol-3-amine |
| SMILES | CNc1noc(-c2ccccn2)n1 |
| InChI | InChI=1S/C8H8N4O/c1-9-8-11-7(13-12-8)6-4-2-3-5-10-6/h2-5H,1H3,(H,9,12) |
| InChIKey | KHRFYRYTVSNBBH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |