C12H11NO3 — CID 870098
methyl 3-(2-methylphenyl)-1,2-oxazole-4-carboxylate (PubChem CID 870098) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is methyl 3-(2-methylphenyl)-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 3-(2-methylphenyl)-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 870098 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | methyl 3-(2-methylphenyl)-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1conc1-c1ccccc1C |
| InChI | InChI=1S/C12H11NO3/c1-8-5-3-4-6-9(8)11-10(7-16-13-11)12(14)15-2/h3-7H,1-2H3 |
| InChIKey | OHXKZSFXLCIDDZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |