C15H14O5 — CID 141186952
dimethyl 2-(2-methylphenyl)furan-3,4-dicarboxylate (PubChem CID 141186952) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is dimethyl 2-(2-methylphenyl)furan-3,4-dicarboxylate.
| Compound Name | dimethyl 2-(2-methylphenyl)furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 141186952 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | dimethyl 2-(2-methylphenyl)furan-3,4-dicarboxylate |
| SMILES | COC(=O)c1coc(-c2ccccc2C)c1C(=O)OC |
| InChI | InChI=1S/C15H14O5/c1-9-6-4-5-7-10(9)13-12(15(17)19-3)11(8-20-13)14(16)18-2/h4-8H,1-3H3 |
| InChIKey | LCEJBWJRNWRFEL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |