C14H11ClO5 — CID 11770872
dimethyl 2-(4-chlorophenyl)furan-3,4-dicarboxylate (PubChem CID 11770872) has the molecular formula C14H11ClO5 and a molecular weight of 294.69 g/mol. Its IUPAC name is dimethyl 2-(4-chlorophenyl)furan-3,4-dicarboxylate.
| Compound Name | dimethyl 2-(4-chlorophenyl)furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 11770872 |
| Molecular Formula | C14H11ClO5 |
| Molecular Weight | 294.69 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | dimethyl 2-(4-chlorophenyl)furan-3,4-dicarboxylate |
| SMILES | COC(=O)c1coc(-c2ccc(Cl)cc2)c1C(=O)OC |
| InChI | InChI=1S/C14H11ClO5/c1-18-13(16)10-7-20-12(11(10)14(17)19-2)8-3-5-9(15)6-4-8/h3-7H,1-2H3 |
| InChIKey | LBWBTALISRHNQH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.69 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |