methyl 4-(3,4-dimethoxybenzoyl)-5-phenylfuran-3-carboxylate

C21H18O6 — CID 56955599

IUPACmethyl 4-(3,4-dimethoxybenzoyl)-5-phenylfuran-3-carboxylate
SMILESCOC(=O)c1coc(-c2ccccc2)c1C(=O)c1ccc(OC)c(OC)c1
InChIInChI=1S/C21H18O6/c1-24-16-10-9-14(11-17(16)25-2)19(22)18-15(21(23)26-3)12-27-20(18)13-7-5-4-6-8-13/h4-12H,1-3H3
InChIKeyRCEPCGWADCZAHN-UHFFFAOYSA-N
MW366.37 g/mol
LogP3.98
Rot. Bonds6

About methyl 4-(3,4-dimethoxybenzoyl)-5-phenylfuran-3-carboxylate

methyl 4-(3,4-dimethoxybenzoyl)-5-phenylfuran-3-carboxylate (PubChem CID 56955599) has the molecular formula C21H18O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is methyl 4-(3,4-dimethoxybenzoyl)-5-phenylfuran-3-carboxylate.

Molecular Properties

Compound Namemethyl 4-(3,4-dimethoxybenzoyl)-5-phenylfuran-3-carboxylate
PubChem CID56955599
Molecular FormulaC21H18O6
Molecular Weight366.37 g/mol
Exact Mass366.11
IUPAC Namemethyl 4-(3,4-dimethoxybenzoyl)-5-phenylfuran-3-carboxylate
SMILESCOC(=O)c1coc(-c2ccccc2)c1C(=O)c1ccc(OC)c(OC)c1
InChIInChI=1S/C21H18O6/c1-24-16-10-9-14(11-17(16)25-2)19(22)18-15(21(23)26-3)12-27-20(18)13-7-5-4-6-8-13/h4-12H,1-3H3
InChIKeyRCEPCGWADCZAHN-UHFFFAOYSA-N
XLogP3.98
TPSA74.97 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500366.37
LogP ≤ 53.98
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 4-(3,4-dimethoxybenzoyl)-5-phenylfuran-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(3,4-dimethoxybenzoyl)-5-phenylfuran-3-carboxylate?
The IUPAC name of methyl 4-(3,4-dimethoxybenzoyl)-5-phenylfuran-3-carboxylate (CID 56955599) is methyl 4-(3,4-dimethoxybenzoyl)-5-phenylfuran-3-carboxylate.
What is the SMILES notation for methyl 4-(3,4-dimethoxybenzoyl)-5-phenylfuran-3-carboxylate?
The canonical SMILES for methyl 4-(3,4-dimethoxybenzoyl)-5-phenylfuran-3-carboxylate is COC(=O)c1coc(-c2ccccc2)c1C(=O)c1ccc(OC)c(OC)c1.
What is the InChIKey of methyl 4-(3,4-dimethoxybenzoyl)-5-phenylfuran-3-carboxylate?
The InChIKey is RCEPCGWADCZAHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18O6/c1-24-16-10-9-14(11-17(16)25-2)19(22)18-15(21(23)26-3)12-27-20(18)13-7-5-4-6-8-13/h4-12H,1-3H3.
What are the key properties of methyl 4-(3,4-dimethoxybenzoyl)-5-phenylfuran-3-carboxylate?
methyl 4-(3,4-dimethoxybenzoyl)-5-phenylfuran-3-carboxylate has a molecular weight of 366.37 g/mol, XLogP of 3.98, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3,4-dimethoxybenzoyl)-5-phenylfuran-3-carboxylate is sourced from PubChem (CID 56955599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).