C16H17N2O4+ — CID 4086386
[amino-(3,4-dimethoxyphenyl)methylidene]-benzoyloxyazanium (PubChem CID 4086386) has the molecular formula C16H17N2O4+ and a molecular weight of 301.32 g/mol. Its IUPAC name is [amino-(3,4-dimethoxyphenyl)methylidene]-benzoyloxyazanium.
| Compound Name | [amino-(3,4-dimethoxyphenyl)methylidene]-benzoyloxyazanium |
|---|---|
| PubChem CID | 4086386 |
| Molecular Formula | C16H17N2O4+ |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | [amino-(3,4-dimethoxyphenyl)methylidene]-benzoyloxyazanium |
| SMILES | COc1ccc(C(N)=[NH+]OC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C16H16N2O4/c1-20-13-9-8-12(10-14(13)21-2)15(17)18-22-16(19)11-6-4-3-5-7-11/h3-10H,1-2H3,(H2,17,18)/p+1 |
| InChIKey | XPIYUHVGEXLSEI-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|