C18H21N2O5+ — CID 4225617
[1-amino-2-(2-methoxyphenyl)ethylidene]-(3,4-dimethoxybenzoyl)oxyazanium (PubChem CID 4225617) has the molecular formula C18H21N2O5+ and a molecular weight of 345.38 g/mol. Its IUPAC name is [1-amino-2-(2-methoxyphenyl)ethylidene]-(3,4-dimethoxybenzoyl)oxyazanium.
| Compound Name | [1-amino-2-(2-methoxyphenyl)ethylidene]-(3,4-dimethoxybenzoyl)oxyazanium |
|---|---|
| PubChem CID | 4225617 |
| Molecular Formula | C18H21N2O5+ |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | [1-amino-2-(2-methoxyphenyl)ethylidene]-(3,4-dimethoxybenzoyl)oxyazanium |
| SMILES | COc1ccccc1CC(N)=[NH+]OC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H20N2O5/c1-22-14-7-5-4-6-12(14)11-17(19)20-25-18(21)13-8-9-15(23-2)16(10-13)24-3/h4-10H,11H2,1-3H3,(H2,19,20)/p+1 |
| InChIKey | RDUXHEIFRMJTMH-UHFFFAOYSA-O |
| XLogP | 0.46 |
| TPSA | 93.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|