C15H14O5 — CID 43321207
1-(3,4-dimethoxyphenyl)-3-(furan-2-yl)propane-1,3-dione (PubChem CID 43321207) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-(furan-2-yl)propane-1,3-dione.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-(furan-2-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 43321207 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(furan-2-yl)propane-1,3-dione |
| SMILES | COc1ccc(C(=O)CC(=O)c2ccco2)cc1OC |
| InChI | InChI=1S/C15H14O5/c1-18-14-6-5-10(8-15(14)19-2)11(16)9-12(17)13-4-3-7-20-13/h3-8H,9H2,1-2H3 |
| InChIKey | WCEOHNXUJNAEGU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|