C16H16O4 — CID 43321190
1-(furan-2-yl)-3-(4-propoxyphenyl)propane-1,3-dione (PubChem CID 43321190) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-(furan-2-yl)-3-(4-propoxyphenyl)propane-1,3-dione.
| Compound Name | 1-(furan-2-yl)-3-(4-propoxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 43321190 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-(furan-2-yl)-3-(4-propoxyphenyl)propane-1,3-dione |
| SMILES | CCCOc1ccc(C(=O)CC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C16H16O4/c1-2-9-19-13-7-5-12(6-8-13)14(17)11-15(18)16-4-3-10-20-16/h3-8,10H,2,9,11H2,1H3 |
| InChIKey | VZMLXPLWKXSVPB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|