C16H18O3S — CID 82050332
2-(furan-2-ylmethylsulfanyl)-1-(4-propoxyphenyl)ethanone (PubChem CID 82050332) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is 2-(furan-2-ylmethylsulfanyl)-1-(4-propoxyphenyl)ethanone.
| Compound Name | 2-(furan-2-ylmethylsulfanyl)-1-(4-propoxyphenyl)ethanone |
|---|---|
| PubChem CID | 82050332 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-(furan-2-ylmethylsulfanyl)-1-(4-propoxyphenyl)ethanone |
| SMILES | CCCOc1ccc(C(=O)CSCc2ccco2)cc1 |
| InChI | InChI=1S/C16H18O3S/c1-2-9-18-14-7-5-13(6-8-14)16(17)12-20-11-15-4-3-10-19-15/h3-8,10H,2,9,11-12H2,1H3 |
| InChIKey | BMQLZNHIZXPJRF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |