C25H30N2O4 — CID 19243761
N-(furan-2-ylmethyl)-N-[(5-piperidin-1-ylfuran-2-yl)methyl]-4-propoxybenzamide (PubChem CID 19243761) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-[(5-piperidin-1-ylfuran-2-yl)methyl]-4-propoxybenzamide.
| Compound Name | N-(furan-2-ylmethyl)-N-[(5-piperidin-1-ylfuran-2-yl)methyl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 19243761 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-[(5-piperidin-1-ylfuran-2-yl)methyl]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N(Cc2ccco2)Cc2ccc(N3CCCCC3)o2)cc1 |
| InChI | InChI=1S/C25H30N2O4/c1-2-16-29-21-10-8-20(9-11-21)25(28)27(18-22-7-6-17-30-22)19-23-12-13-24(31-23)26-14-4-3-5-15-26/h6-13,17H,2-5,14-16,18-19H2,1H3 |
| InChIKey | MVQUYSCQFZEVGU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 59.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |