C22H23FN2O3 — CID 19243795
2-fluoro-N-(furan-2-ylmethyl)-N-[(5-piperidin-1-ylfuran-2-yl)methyl]benzamide (PubChem CID 19243795) has the molecular formula C22H23FN2O3 and a molecular weight of 382.44 g/mol. Its IUPAC name is 2-fluoro-N-(furan-2-ylmethyl)-N-[(5-piperidin-1-ylfuran-2-yl)methyl]benzamide.
| Compound Name | 2-fluoro-N-(furan-2-ylmethyl)-N-[(5-piperidin-1-ylfuran-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 19243795 |
| Molecular Formula | C22H23FN2O3 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 2-fluoro-N-(furan-2-ylmethyl)-N-[(5-piperidin-1-ylfuran-2-yl)methyl]benzamide |
| SMILES | O=C(c1ccccc1F)N(Cc1ccco1)Cc1ccc(N2CCCCC2)o1 |
| InChI | InChI=1S/C22H23FN2O3/c23-20-9-3-2-8-19(20)22(26)25(15-17-7-6-14-27-17)16-18-10-11-21(28-18)24-12-4-1-5-13-24/h2-3,6-11,14H,1,4-5,12-13,15-16H2 |
| InChIKey | XVWRFGWGKNRRKV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 49.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |