C23H21Cl5N2O4 — CID 19243809
N-(furan-2-ylmethyl)-2-(2,3,4,5,6-pentachlorophenoxy)-N-[(5-piperidin-1-ylfuran-2-yl)methyl]acetamide (PubChem CID 19243809) has the molecular formula C23H21Cl5N2O4 and a molecular weight of 566.70 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(2,3,4,5,6-pentachlorophenoxy)-N-[(5-piperidin-1-ylfuran-2-yl)methyl]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(2,3,4,5,6-pentachlorophenoxy)-N-[(5-piperidin-1-ylfuran-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 19243809 |
| Molecular Formula | C23H21Cl5N2O4 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 563.99 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(2,3,4,5,6-pentachlorophenoxy)-N-[(5-piperidin-1-ylfuran-2-yl)methyl]acetamide |
| SMILES | O=C(COc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl)N(Cc1ccco1)Cc1ccc(N2CCCCC2)o1 |
| InChI | InChI=1S/C23H21Cl5N2O4/c24-18-19(25)21(27)23(22(28)20(18)26)33-13-16(31)30(11-14-5-4-10-32-14)12-15-6-7-17(34-15)29-8-2-1-3-9-29/h4-7,10H,1-3,8-9,11-13H2 |
| InChIKey | XVUZCIJORZEZAT-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 59.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|