C22H18Cl5NO4 — CID 19244113
N-(furan-2-ylmethyl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]-2-(2,3,4,5,6-pentachlorophenoxy)acetamide (PubChem CID 19244113) has the molecular formula C22H18Cl5NO4 and a molecular weight of 537.65 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]-2-(2,3,4,5,6-pentachlorophenoxy)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]-2-(2,3,4,5,6-pentachlorophenoxy)acetamide |
|---|---|
| PubChem CID | 19244113 |
| Molecular Formula | C22H18Cl5NO4 |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 534.97 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]-2-(2,3,4,5,6-pentachlorophenoxy)acetamide |
| SMILES | CC1CC1c1ccc(CN(Cc2ccco2)C(=O)COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C22H18Cl5NO4/c1-11-7-14(11)15-5-4-13(32-15)9-28(8-12-3-2-6-30-12)16(29)10-31-22-20(26)18(24)17(23)19(25)21(22)27/h2-6,11,14H,7-10H2,1H3 |
| InChIKey | LDVPHCUWQRMHQM-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 55.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|