C19H19NO4 — CID 19244052
N-(furan-2-ylmethyl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]furan-2-carboxamide (PubChem CID 19244052) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]furan-2-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19244052 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]furan-2-carboxamide |
| SMILES | CC1CC1c1ccc(CN(Cc2ccco2)C(=O)c2ccco2)o1 |
| InChI | InChI=1S/C19H19NO4/c1-13-10-16(13)17-7-6-15(24-17)12-20(11-14-4-2-8-22-14)19(21)18-5-3-9-23-18/h2-9,13,16H,10-12H2,1H3 |
| InChIKey | ZYYSCTCKXIBAFS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |