C21H20FNO3 — CID 19244099
2-fluoro-N-(furan-2-ylmethyl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]benzamide (PubChem CID 19244099) has the molecular formula C21H20FNO3 and a molecular weight of 353.39 g/mol. Its IUPAC name is 2-fluoro-N-(furan-2-ylmethyl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]benzamide.
| Compound Name | 2-fluoro-N-(furan-2-ylmethyl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 19244099 |
| Molecular Formula | C21H20FNO3 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-fluoro-N-(furan-2-ylmethyl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]benzamide |
| SMILES | CC1CC1c1ccc(CN(Cc2ccco2)C(=O)c2ccccc2F)o1 |
| InChI | InChI=1S/C21H20FNO3/c1-14-11-18(14)20-9-8-16(26-20)13-23(12-15-5-4-10-25-15)21(24)17-6-2-3-7-19(17)22/h2-10,14,18H,11-13H2,1H3 |
| InChIKey | SEASQNJPTCJCGU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 46.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |