C25H25N3O8 — CID 55317171
[2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-(furan-2-carbonylamino)-3-phenylpropanoate (PubChem CID 55317171) has the molecular formula C25H25N3O8 and a molecular weight of 495.49 g/mol. Its IUPAC name is [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-(furan-2-carbonylamino)-3-phenylpropanoate.
| Compound Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-(furan-2-carbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 55317171 |
| Molecular Formula | C25H25N3O8 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-(furan-2-carbonylamino)-3-phenylpropanoate |
| SMILES | COc1ccc(C(=O)NNC(=O)COC(=O)C(Cc2ccccc2)NC(=O)c2ccco2)cc1OC |
| InChI | InChI=1S/C25H25N3O8/c1-33-19-11-10-17(14-21(19)34-2)23(30)28-27-22(29)15-36-25(32)18(13-16-7-4-3-5-8-16)26-24(31)20-9-6-12-35-20/h3-12,14,18H,13,15H2,1-2H3,(H,26,31)(H,27,29)(H,28,30) |
| InChIKey | CNVHYDIMTGQILT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 145.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|