C19H16O6 — CID 91186499
(4,5-dihydroxy-6,7-dimethylidene-1-benzofuran-3-yl)-(3,4-dimethoxyphenyl)methanone (PubChem CID 91186499) has the molecular formula C19H16O6 and a molecular weight of 340.33 g/mol. Its IUPAC name is (4,5-dihydroxy-6,7-dimethylidene-1-benzofuran-3-yl)-(3,4-dimethoxyphenyl)methanone.
| Compound Name | (4,5-dihydroxy-6,7-dimethylidene-1-benzofuran-3-yl)-(3,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 91186499 |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (4,5-dihydroxy-6,7-dimethylidene-1-benzofuran-3-yl)-(3,4-dimethoxyphenyl)methanone |
| SMILES | C=c1c(O)c(O)c2c(C(=O)c3ccc(OC)c(OC)c3)coc2c1=C |
| InChI | InChI=1S/C19H16O6/c1-9-10(2)19-15(18(22)16(9)20)12(8-25-19)17(21)11-5-6-13(23-3)14(7-11)24-4/h5-8,20,22H,1-2H2,3-4H3 |
| InChIKey | GYXXAXFDASGWKH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|