C16H14O7 — CID 14902064
dimethyl 2-(2-methoxycarbonylphenyl)furan-3,4-dicarboxylate (PubChem CID 14902064) has the molecular formula C16H14O7 and a molecular weight of 318.28 g/mol. Its IUPAC name is dimethyl 2-(2-methoxycarbonylphenyl)furan-3,4-dicarboxylate.
| Compound Name | dimethyl 2-(2-methoxycarbonylphenyl)furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 14902064 |
| Molecular Formula | C16H14O7 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | dimethyl 2-(2-methoxycarbonylphenyl)furan-3,4-dicarboxylate |
| SMILES | COC(=O)c1ccccc1-c1occ(C(=O)OC)c1C(=O)OC |
| InChI | InChI=1S/C16H14O7/c1-20-14(17)10-7-5-4-6-9(10)13-12(16(19)22-3)11(8-23-13)15(18)21-2/h4-8H,1-3H3 |
| InChIKey | MUJVEESFEHBRTF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|